About (3-cyano-3-methylbutyl) 4-amino-3-chlorobenzoate
(3-cyano-3-methylbutyl) 4-amino-3-chlorobenzoate (PubChem CID 82786965) has the molecular formula C13H15ClN2O2
and a molecular weight of 266.73 g/mol. Its IUPAC name is (3-cyano-3-methylbutyl) 4-amino-3-chlorobenzoate.
Molecular Properties
| Compound Name | (3-cyano-3-methylbutyl) 4-amino-3-chlorobenzoate |
| PubChem CID | 82786965 |
| Molecular Formula | C13H15ClN2O2 |
| Molecular Weight | 266.73 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | (3-cyano-3-methylbutyl) 4-amino-3-chlorobenzoate |
| SMILES | CC(C)(C#N)CCOC(=O)c1ccc(N)c(Cl)c1 |
| InChI | InChI=1S/C13H15ClN2O2/c1-13(2,8-15)5-6-18-12(17)9-3-4-11(16)10(14)7-9/h3-4,7H,5-6,16H2,1-2H3 |
| InChIKey | ORQHIOBWSPIUIQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.73 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (3-cyano-3-methylbutyl) 4-amino-3-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-cyano-3-methylbutyl) 4-amino-3-chlorobenzoate?
The IUPAC name of (3-cyano-3-methylbutyl) 4-amino-3-chlorobenzoate (CID 82786965) is (3-cyano-3-methylbutyl) 4-amino-3-chlorobenzoate.
What is the SMILES notation for (3-cyano-3-methylbutyl) 4-amino-3-chlorobenzoate?
The canonical SMILES for (3-cyano-3-methylbutyl) 4-amino-3-chlorobenzoate is CC(C)(C#N)CCOC(=O)c1ccc(N)c(Cl)c1.
What is the InChIKey of (3-cyano-3-methylbutyl) 4-amino-3-chlorobenzoate?
The InChIKey is ORQHIOBWSPIUIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15ClN2O2/c1-13(2,8-15)5-6-18-12(17)9-3-4-11(16)10(14)7-9/h3-4,7H,5-6,16H2,1-2H3.
What are the key properties of (3-cyano-3-methylbutyl) 4-amino-3-chlorobenzoate?
(3-cyano-3-methylbutyl) 4-amino-3-chlorobenzoate has a molecular weight of 266.73 g/mol, XLogP of 3.02, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-cyano-3-methylbutyl) 4-amino-3-chlorobenzoate is sourced from PubChem (CID 82786965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).