About 4-methoxybutyl 4-amino-3-chlorobenzoate
4-methoxybutyl 4-amino-3-chlorobenzoate (PubChem CID 104648957) has the molecular formula C12H16ClNO3
and a molecular weight of 257.72 g/mol. Its IUPAC name is 4-methoxybutyl 4-amino-3-chlorobenzoate.
Molecular Properties
| Compound Name | 4-methoxybutyl 4-amino-3-chlorobenzoate |
| PubChem CID | 104648957 |
| Molecular Formula | C12H16ClNO3 |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 4-methoxybutyl 4-amino-3-chlorobenzoate |
| SMILES | COCCCCOC(=O)c1ccc(N)c(Cl)c1 |
| InChI | InChI=1S/C12H16ClNO3/c1-16-6-2-3-7-17-12(15)9-4-5-11(14)10(13)8-9/h4-5,8H,2-3,6-7,14H2,1H3 |
| InChIKey | RYPPNFGUXPZKGX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxybutyl 4-amino-3-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxybutyl 4-amino-3-chlorobenzoate?
The IUPAC name of 4-methoxybutyl 4-amino-3-chlorobenzoate (CID 104648957) is 4-methoxybutyl 4-amino-3-chlorobenzoate.
What is the SMILES notation for 4-methoxybutyl 4-amino-3-chlorobenzoate?
The canonical SMILES for 4-methoxybutyl 4-amino-3-chlorobenzoate is COCCCCOC(=O)c1ccc(N)c(Cl)c1.
What is the InChIKey of 4-methoxybutyl 4-amino-3-chlorobenzoate?
The InChIKey is RYPPNFGUXPZKGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16ClNO3/c1-16-6-2-3-7-17-12(15)9-4-5-11(14)10(13)8-9/h4-5,8H,2-3,6-7,14H2,1H3.
What are the key properties of 4-methoxybutyl 4-amino-3-chlorobenzoate?
4-methoxybutyl 4-amino-3-chlorobenzoate has a molecular weight of 257.72 g/mol, XLogP of 2.51, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxybutyl 4-amino-3-chlorobenzoate is sourced from PubChem (CID 104648957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).