C13H14F2N2O2 — CID 104700344
(3-cyano-3-methylbutyl) 4-amino-2,5-difluorobenzoate (PubChem CID 104700344) has the molecular formula C13H14F2N2O2 and a molecular weight of 268.26 g/mol. Its IUPAC name is (3-cyano-3-methylbutyl) 4-amino-2,5-difluorobenzoate.
| Compound Name | (3-cyano-3-methylbutyl) 4-amino-2,5-difluorobenzoate |
|---|---|
| PubChem CID | 104700344 |
| Molecular Formula | C13H14F2N2O2 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | (3-cyano-3-methylbutyl) 4-amino-2,5-difluorobenzoate |
| SMILES | CC(C)(C#N)CCOC(=O)c1cc(F)c(N)cc1F |
| InChI | InChI=1S/C13H14F2N2O2/c1-13(2,7-16)3-4-19-12(18)8-5-10(15)11(17)6-9(8)14/h5-6H,3-4,17H2,1-2H3 |
| InChIKey | IMSPUSSELIIYTG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|