C16H15BrFNO2 — CID 102706123
(4-bromo-2-fluorophenyl)methyl 5-amino-2,4-dimethylbenzoate (PubChem CID 102706123) has the molecular formula C16H15BrFNO2 and a molecular weight of 352.20 g/mol. Its IUPAC name is (4-bromo-2-fluorophenyl)methyl 5-amino-2,4-dimethylbenzoate.
| Compound Name | (4-bromo-2-fluorophenyl)methyl 5-amino-2,4-dimethylbenzoate |
|---|---|
| PubChem CID | 102706123 |
| Molecular Formula | C16H15BrFNO2 |
| Molecular Weight | 352.20 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | (4-bromo-2-fluorophenyl)methyl 5-amino-2,4-dimethylbenzoate |
| SMILES | Cc1cc(C)c(C(=O)OCc2ccc(Br)cc2F)cc1N |
| InChI | InChI=1S/C16H15BrFNO2/c1-9-5-10(2)15(19)7-13(9)16(20)21-8-11-3-4-12(17)6-14(11)18/h3-7H,8,19H2,1-2H3 |
| InChIKey | GGBGODFTZHDURB-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.20 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|