C16H15Cl2NO2 — CID 102706266
(2,6-dichlorophenyl)methyl 5-amino-2,4-dimethylbenzoate (PubChem CID 102706266) has the molecular formula C16H15Cl2NO2 and a molecular weight of 324.21 g/mol. Its IUPAC name is (2,6-dichlorophenyl)methyl 5-amino-2,4-dimethylbenzoate.
| Compound Name | (2,6-dichlorophenyl)methyl 5-amino-2,4-dimethylbenzoate |
|---|---|
| PubChem CID | 102706266 |
| Molecular Formula | C16H15Cl2NO2 |
| Molecular Weight | 324.21 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | (2,6-dichlorophenyl)methyl 5-amino-2,4-dimethylbenzoate |
| SMILES | Cc1cc(C)c(C(=O)OCc2c(Cl)cccc2Cl)cc1N |
| InChI | InChI=1S/C16H15Cl2NO2/c1-9-6-10(2)15(19)7-11(9)16(20)21-8-12-13(17)4-3-5-14(12)18/h3-7H,8,19H2,1-2H3 |
| InChIKey | ORRBUIHJFBFNBM-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.21 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|