C15H10Cl2O4 — CID 4126924
2-[(2,6-dichlorophenyl)methoxycarbonyl]benzoic acid (PubChem CID 4126924) has the molecular formula C15H10Cl2O4 and a molecular weight of 325.15 g/mol. Its IUPAC name is 2-[(2,6-dichlorophenyl)methoxycarbonyl]benzoic acid.
| Compound Name | 2-[(2,6-dichlorophenyl)methoxycarbonyl]benzoic acid |
|---|---|
| PubChem CID | 4126924 |
| Molecular Formula | C15H10Cl2O4 |
| Molecular Weight | 325.15 g/mol |
| Exact Mass | 324.00 |
| IUPAC Name | 2-[(2,6-dichlorophenyl)methoxycarbonyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1C(=O)OCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C15H10Cl2O4/c16-12-6-3-7-13(17)11(12)8-21-15(20)10-5-2-1-4-9(10)14(18)19/h1-7H,8H2,(H,18,19) |
| InChIKey | NWELFBBPILOGIQ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.15 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |