C14H5Cl2F5O2 — CID 91743056
(2,6-dichlorophenyl)methyl 2,3,4,5,6-pentafluorobenzoate (PubChem CID 91743056) has the molecular formula C14H5Cl2F5O2 and a molecular weight of 371.09 g/mol. Its IUPAC name is (2,6-dichlorophenyl)methyl 2,3,4,5,6-pentafluorobenzoate.
| Compound Name | (2,6-dichlorophenyl)methyl 2,3,4,5,6-pentafluorobenzoate |
|---|---|
| PubChem CID | 91743056 |
| Molecular Formula | C14H5Cl2F5O2 |
| Molecular Weight | 371.09 g/mol |
| Exact Mass | 369.96 |
| IUPAC Name | (2,6-dichlorophenyl)methyl 2,3,4,5,6-pentafluorobenzoate |
| SMILES | O=C(OCc1c(Cl)cccc1Cl)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C14H5Cl2F5O2/c15-6-2-1-3-7(16)5(6)4-23-14(22)8-9(17)11(19)13(21)12(20)10(8)18/h1-3H,4H2 |
| InChIKey | NAAOEJFYVCSMRU-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.09 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|