C14H9Cl2IO2 — CID 2409698
(2,6-dichlorophenyl)methyl 4-iodobenzoate (PubChem CID 2409698) has the molecular formula C14H9Cl2IO2 and a molecular weight of 407.03 g/mol. Its IUPAC name is (2,6-dichlorophenyl)methyl 4-iodobenzoate.
| Compound Name | (2,6-dichlorophenyl)methyl 4-iodobenzoate |
|---|---|
| PubChem CID | 2409698 |
| Molecular Formula | C14H9Cl2IO2 |
| Molecular Weight | 407.03 g/mol |
| Exact Mass | 405.90 |
| IUPAC Name | (2,6-dichlorophenyl)methyl 4-iodobenzoate |
| SMILES | O=C(OCc1c(Cl)cccc1Cl)c1ccc(I)cc1 |
| InChI | InChI=1S/C14H9Cl2IO2/c15-12-2-1-3-13(16)11(12)8-19-14(18)9-4-6-10(17)7-5-9/h1-7H,8H2 |
| InChIKey | SZBAXOCUOFCBKM-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.03 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|