C13H9Cl2IO — CID 60627529
1,3-dichloro-2-[(4-iodophenoxy)methyl]benzene (PubChem CID 60627529) has the molecular formula C13H9Cl2IO and a molecular weight of 379.02 g/mol. Its IUPAC name is 1,3-dichloro-2-[(4-iodophenoxy)methyl]benzene.
| Compound Name | 1,3-dichloro-2-[(4-iodophenoxy)methyl]benzene |
|---|---|
| PubChem CID | 60627529 |
| Molecular Formula | C13H9Cl2IO |
| Molecular Weight | 379.02 g/mol |
| Exact Mass | 377.91 |
| IUPAC Name | 1,3-dichloro-2-[(4-iodophenoxy)methyl]benzene |
| SMILES | Clc1cccc(Cl)c1COc1ccc(I)cc1 |
| InChI | InChI=1S/C13H9Cl2IO/c14-12-2-1-3-13(15)11(12)8-17-10-6-4-9(16)5-7-10/h1-7H,8H2 |
| InChIKey | YZEXJGKGXVTMLL-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.02 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|