C17H20Cl2O — CID 142233914
1,3-dichloro-2-[(4-ethylphenoxy)methyl]benzene;ethane (PubChem CID 142233914) has the molecular formula C17H20Cl2O and a molecular weight of 311.25 g/mol. Its IUPAC name is 1,3-dichloro-2-[(4-ethylphenoxy)methyl]benzene;ethane.
| Compound Name | 1,3-dichloro-2-[(4-ethylphenoxy)methyl]benzene;ethane |
|---|---|
| PubChem CID | 142233914 |
| Molecular Formula | C17H20Cl2O |
| Molecular Weight | 311.25 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 1,3-dichloro-2-[(4-ethylphenoxy)methyl]benzene;ethane |
| SMILES | CC.CCc1ccc(OCc2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C15H14Cl2O.C2H6/c1-2-11-6-8-12(9-7-11)18-10-13-14(16)4-3-5-15(13)17;1-2/h3-9H,2,10H2,1H3;1-2H3 |
| InChIKey | FDSGDXVFFXSAIK-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.25 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |