C13H9BrCl2O — CID 925892
2-[(4-bromophenoxy)methyl]-1,3-dichlorobenzene (PubChem CID 925892) has the molecular formula C13H9BrCl2O and a molecular weight of 332.02 g/mol. Its IUPAC name is 2-[(4-bromophenoxy)methyl]-1,3-dichlorobenzene.
| Compound Name | 2-[(4-bromophenoxy)methyl]-1,3-dichlorobenzene |
|---|---|
| PubChem CID | 925892 |
| Molecular Formula | C13H9BrCl2O |
| Molecular Weight | 332.02 g/mol |
| Exact Mass | 329.92 |
| IUPAC Name | 2-[(4-bromophenoxy)methyl]-1,3-dichlorobenzene |
| SMILES | Clc1cccc(Cl)c1COc1ccc(Br)cc1 |
| InChI | InChI=1S/C13H9BrCl2O/c14-9-4-6-10(7-5-9)17-8-11-12(15)2-1-3-13(11)16/h1-7H,8H2 |
| InChIKey | NWZUZVQSTNYDIU-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.02 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |