C13H9BCl2F3KO — CID 63677693
potassium [4-[(2,6-dichlorophenyl)methoxy]phenyl]-trifluoroboranuide (PubChem CID 63677693) has the molecular formula C13H9BCl2F3KO and a molecular weight of 359.02 g/mol. Its IUPAC name is potassium [4-[(2,6-dichlorophenyl)methoxy]phenyl]-trifluoroboranuide.
| Compound Name | potassium [4-[(2,6-dichlorophenyl)methoxy]phenyl]-trifluoroboranuide |
|---|---|
| PubChem CID | 63677693 |
| Molecular Formula | C13H9BCl2F3KO |
| Molecular Weight | 359.02 g/mol |
| Exact Mass | 357.97 |
| IUPAC Name | potassium [4-[(2,6-dichlorophenyl)methoxy]phenyl]-trifluoroboranuide |
| SMILES | F[B-](F)(F)c1ccc(OCc2c(Cl)cccc2Cl)cc1.[K+] |
| InChI | InChI=1S/C13H9BCl2F3O.K/c15-12-2-1-3-13(16)11(12)8-20-10-6-4-9(5-7-10)14(17,18)19;/h1-7H,8H2;/q-1;+1 |
| InChIKey | FMBXTGIVDRAXMK-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.02 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|