C13H9BCl2F3O- — CID 63677225
[2-[(2,6-dichlorophenyl)methoxy]phenyl]-trifluoroboranuide (PubChem CID 63677225) has the molecular formula C13H9BCl2F3O- and a molecular weight of 319.93 g/mol. Its IUPAC name is [2-[(2,6-dichlorophenyl)methoxy]phenyl]-trifluoroboranuide.
| Compound Name | [2-[(2,6-dichlorophenyl)methoxy]phenyl]-trifluoroboranuide |
|---|---|
| PubChem CID | 63677225 |
| Molecular Formula | C13H9BCl2F3O- |
| Molecular Weight | 319.93 g/mol |
| Exact Mass | 319.01 |
| IUPAC Name | [2-[(2,6-dichlorophenyl)methoxy]phenyl]-trifluoroboranuide |
| SMILES | F[B-](F)(F)c1ccccc1OCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H9BCl2F3O/c15-11-5-3-6-12(16)9(11)8-20-13-7-2-1-4-10(13)14(17,18)19/h1-7H,8H2/q-1 |
| InChIKey | ANPVXJYPFNREPX-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.93 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|