C14H9Cl2FO3 — CID 115298074
2-[(2,6-dichlorophenyl)methoxy]-5-fluorobenzoic acid (PubChem CID 115298074) has the molecular formula C14H9Cl2FO3 and a molecular weight of 315.13 g/mol. Its IUPAC name is 2-[(2,6-dichlorophenyl)methoxy]-5-fluorobenzoic acid.
| Compound Name | 2-[(2,6-dichlorophenyl)methoxy]-5-fluorobenzoic acid |
|---|---|
| PubChem CID | 115298074 |
| Molecular Formula | C14H9Cl2FO3 |
| Molecular Weight | 315.13 g/mol |
| Exact Mass | 313.99 |
| IUPAC Name | 2-[(2,6-dichlorophenyl)methoxy]-5-fluorobenzoic acid |
| SMILES | O=C(O)c1cc(F)ccc1OCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H9Cl2FO3/c15-11-2-1-3-12(16)10(11)7-20-13-5-4-8(17)6-9(13)14(18)19/h1-6H,7H2,(H,18,19) |
| InChIKey | CXWKDLCOZVRLSA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.13 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |