C15H11Cl2FO2 — CID 107306486
1-[2-[(2,3-dichlorophenyl)methoxy]-5-fluorophenyl]ethanone (PubChem CID 107306486) has the molecular formula C15H11Cl2FO2 and a molecular weight of 313.16 g/mol. Its IUPAC name is 1-[2-[(2,3-dichlorophenyl)methoxy]-5-fluorophenyl]ethanone.
| Compound Name | 1-[2-[(2,3-dichlorophenyl)methoxy]-5-fluorophenyl]ethanone |
|---|---|
| PubChem CID | 107306486 |
| Molecular Formula | C15H11Cl2FO2 |
| Molecular Weight | 313.16 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | 1-[2-[(2,3-dichlorophenyl)methoxy]-5-fluorophenyl]ethanone |
| SMILES | CC(=O)c1cc(F)ccc1OCc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C15H11Cl2FO2/c1-9(19)12-7-11(18)5-6-14(12)20-8-10-3-2-4-13(16)15(10)17/h2-7H,8H2,1H3 |
| InChIKey | MCCKSIOODHNNOL-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.16 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |