C15H12Cl2FNO2 — CID 107306643
(NZ)-N-[1-[2-[(2,3-dichlorophenyl)methoxy]-4-fluorophenyl]ethylidene]hydroxylamine (PubChem CID 107306643) has the molecular formula C15H12Cl2FNO2 and a molecular weight of 328.17 g/mol. Its IUPAC name is (NZ)-N-[1-[2-[(2,3-dichlorophenyl)methoxy]-4-fluorophenyl]ethylidene]hydroxylamine.
| Compound Name | (NZ)-N-[1-[2-[(2,3-dichlorophenyl)methoxy]-4-fluorophenyl]ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 107306643 |
| Molecular Formula | C15H12Cl2FNO2 |
| Molecular Weight | 328.17 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | (NZ)-N-[1-[2-[(2,3-dichlorophenyl)methoxy]-4-fluorophenyl]ethylidene]hydroxylamine |
| SMILES | C/C(=N/O)c1ccc(F)cc1OCc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C15H12Cl2FNO2/c1-9(19-20)12-6-5-11(18)7-14(12)21-8-10-3-2-4-13(16)15(10)17/h2-7,20H,8H2,1H3/b19-9- |
| InChIKey | KJIPRWCIDRJEQE-OCKHKDLRSA-N |
| XLogP | 4.91 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.17 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|