C15H12ClF2NO2 — CID 114849679
(NZ)-N-[1-[2-[(4-chloro-2-fluorophenyl)methoxy]-5-fluorophenyl]ethylidene]hydroxylamine (PubChem CID 114849679) has the molecular formula C15H12ClF2NO2 and a molecular weight of 311.72 g/mol. Its IUPAC name is (NZ)-N-[1-[2-[(4-chloro-2-fluorophenyl)methoxy]-5-fluorophenyl]ethylidene]hydroxylamine.
| Compound Name | (NZ)-N-[1-[2-[(4-chloro-2-fluorophenyl)methoxy]-5-fluorophenyl]ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 114849679 |
| Molecular Formula | C15H12ClF2NO2 |
| Molecular Weight | 311.72 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | (NZ)-N-[1-[2-[(4-chloro-2-fluorophenyl)methoxy]-5-fluorophenyl]ethylidene]hydroxylamine |
| SMILES | C/C(=N/O)c1cc(F)ccc1OCc1ccc(Cl)cc1F |
| InChI | InChI=1S/C15H12ClF2NO2/c1-9(19-20)13-7-12(17)4-5-15(13)21-8-10-2-3-11(16)6-14(10)18/h2-7,20H,8H2,1H3/b19-9- |
| InChIKey | WRGCQZHCIVBLLJ-OCKHKDLRSA-N |
| XLogP | 4.40 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.72 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|