C16H15ClFNO2 — CID 103046785
(NZ)-N-[1-[2-[(5-chloro-2-fluorophenyl)methoxy]-4-methylphenyl]ethylidene]hydroxylamine (PubChem CID 103046785) has the molecular formula C16H15ClFNO2 and a molecular weight of 307.75 g/mol. Its IUPAC name is (NZ)-N-[1-[2-[(5-chloro-2-fluorophenyl)methoxy]-4-methylphenyl]ethylidene]hydroxylamine.
| Compound Name | (NZ)-N-[1-[2-[(5-chloro-2-fluorophenyl)methoxy]-4-methylphenyl]ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 103046785 |
| Molecular Formula | C16H15ClFNO2 |
| Molecular Weight | 307.75 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | (NZ)-N-[1-[2-[(5-chloro-2-fluorophenyl)methoxy]-4-methylphenyl]ethylidene]hydroxylamine |
| SMILES | C/C(=N/O)c1ccc(C)cc1OCc1cc(Cl)ccc1F |
| InChI | InChI=1S/C16H15ClFNO2/c1-10-3-5-14(11(2)19-20)16(7-10)21-9-12-8-13(17)4-6-15(12)18/h3-8,20H,9H2,1-2H3/b19-11- |
| InChIKey | VYLNSQUULLLOTN-ODLFYWEKSA-N |
| XLogP | 4.56 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.75 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|