C16H16ClFO2 — CID 103046969
(1S)-1-[2-[(5-chloro-2-fluorophenyl)methoxy]-4-methylphenyl]ethanol (PubChem CID 103046969) has the molecular formula C16H16ClFO2 and a molecular weight of 294.75 g/mol. Its IUPAC name is (1S)-1-[2-[(5-chloro-2-fluorophenyl)methoxy]-4-methylphenyl]ethanol.
| Compound Name | (1S)-1-[2-[(5-chloro-2-fluorophenyl)methoxy]-4-methylphenyl]ethanol |
|---|---|
| PubChem CID | 103046969 |
| Molecular Formula | C16H16ClFO2 |
| Molecular Weight | 294.75 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | (1S)-1-[2-[(5-chloro-2-fluorophenyl)methoxy]-4-methylphenyl]ethanol |
| SMILES | Cc1ccc([C@H](C)O)c(OCc2cc(Cl)ccc2F)c1 |
| InChI | InChI=1S/C16H16ClFO2/c1-10-3-5-14(11(2)19)16(7-10)20-9-12-8-13(17)4-6-15(12)18/h3-8,11,19H,9H2,1-2H3/t11-/m0/s1 |
| InChIKey | OBWNCFWMVQTWBA-NSHDSACASA-N |
| XLogP | 4.42 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.75 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |