C16H16Cl2O3 — CID 82002549
(1S)-1-[2-[(2,5-dichlorophenyl)methoxy]-4-methoxyphenyl]ethanol (PubChem CID 82002549) has the molecular formula C16H16Cl2O3 and a molecular weight of 327.21 g/mol. Its IUPAC name is (1S)-1-[2-[(2,5-dichlorophenyl)methoxy]-4-methoxyphenyl]ethanol.
| Compound Name | (1S)-1-[2-[(2,5-dichlorophenyl)methoxy]-4-methoxyphenyl]ethanol |
|---|---|
| PubChem CID | 82002549 |
| Molecular Formula | C16H16Cl2O3 |
| Molecular Weight | 327.21 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | (1S)-1-[2-[(2,5-dichlorophenyl)methoxy]-4-methoxyphenyl]ethanol |
| SMILES | COc1ccc([C@H](C)O)c(OCc2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C16H16Cl2O3/c1-10(19)14-5-4-13(20-2)8-16(14)21-9-11-7-12(17)3-6-15(11)18/h3-8,10,19H,9H2,1-2H3/t10-/m0/s1 |
| InChIKey | LEXXXTLFMFOFCI-JTQLQIEISA-N |
| XLogP | 4.63 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.21 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |