C15H11Cl3O2 — CID 107306491
1-[3-chloro-4-[(2,3-dichlorophenyl)methoxy]phenyl]ethanone (PubChem CID 107306491) has the molecular formula C15H11Cl3O2 and a molecular weight of 329.61 g/mol. Its IUPAC name is 1-[3-chloro-4-[(2,3-dichlorophenyl)methoxy]phenyl]ethanone.
| Compound Name | 1-[3-chloro-4-[(2,3-dichlorophenyl)methoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 107306491 |
| Molecular Formula | C15H11Cl3O2 |
| Molecular Weight | 329.61 g/mol |
| Exact Mass | 327.98 |
| IUPAC Name | 1-[3-chloro-4-[(2,3-dichlorophenyl)methoxy]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(OCc2cccc(Cl)c2Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H11Cl3O2/c1-9(19)10-5-6-14(13(17)7-10)20-8-11-3-2-4-12(16)15(11)18/h2-7H,8H2,1H3 |
| InChIKey | KFXCHTMJWIHAIP-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.61 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |