About butane;1-chloro-2-[(4-ethylphenoxy)methyl]-3-methylbenzene;ethane
butane;1-chloro-2-[(4-ethylphenoxy)methyl]-3-methylbenzene;ethane (PubChem CID 142992216) has the molecular formula C24H39ClO
and a molecular weight of 379.03 g/mol. Its IUPAC name is butane;1-chloro-2-[(4-ethylphenoxy)methyl]-3-methylbenzene;ethane.
Molecular Properties
| Compound Name | butane;1-chloro-2-[(4-ethylphenoxy)methyl]-3-methylbenzene;ethane |
| PubChem CID | 142992216 |
| Molecular Formula | C24H39ClO |
| Molecular Weight | 379.03 g/mol |
| Exact Mass | 378.27 |
| IUPAC Name | butane;1-chloro-2-[(4-ethylphenoxy)methyl]-3-methylbenzene;ethane |
| SMILES | CC.CC.CCCC.CCc1ccc(OCc2c(C)cccc2Cl)cc1 |
| InChI | InChI=1S/C16H17ClO.C4H10.2C2H6/c1-3-13-7-9-14(10-8-13)18-11-15-12(2)5-4-6-16(15)17;1-3-4-2;2*1-2/h4-10H,3,11H2,1-2H3;3-4H2,1-2H3;2*1-2H3 |
| InChIKey | OCWIUUQZTGZSNC-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.03 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze butane;1-chloro-2-[(4-ethylphenoxy)methyl]-3-methylbenzene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;1-chloro-2-[(4-ethylphenoxy)methyl]-3-methylbenzene;ethane?
The IUPAC name of butane;1-chloro-2-[(4-ethylphenoxy)methyl]-3-methylbenzene;ethane (CID 142992216) is butane;1-chloro-2-[(4-ethylphenoxy)methyl]-3-methylbenzene;ethane.
What is the SMILES notation for butane;1-chloro-2-[(4-ethylphenoxy)methyl]-3-methylbenzene;ethane?
The canonical SMILES for butane;1-chloro-2-[(4-ethylphenoxy)methyl]-3-methylbenzene;ethane is CC.CC.CCCC.CCc1ccc(OCc2c(C)cccc2Cl)cc1.
What is the InChIKey of butane;1-chloro-2-[(4-ethylphenoxy)methyl]-3-methylbenzene;ethane?
The InChIKey is OCWIUUQZTGZSNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17ClO.C4H10.2C2H6/c1-3-13-7-9-14(10-8-13)18-11-15-12(2)5-4-6-16(15)17;1-3-4-2;2*1-2/h4-10H,3,11H2,1-2H3;3-4H2,1-2H3;2*1-2H3.
What are the key properties of butane;1-chloro-2-[(4-ethylphenoxy)methyl]-3-methylbenzene;ethane?
butane;1-chloro-2-[(4-ethylphenoxy)methyl]-3-methylbenzene;ethane has a molecular weight of 379.03 g/mol, XLogP of 8.65, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butane;1-chloro-2-[(4-ethylphenoxy)methyl]-3-methylbenzene;ethane is sourced from PubChem (CID 142992216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).