C19H21Cl2NO2 — CID 18678156
1-[2-[4-[(2,6-dichlorophenyl)methoxy]phenoxy]ethyl]pyrrolidine (PubChem CID 18678156) has the molecular formula C19H21Cl2NO2 and a molecular weight of 366.29 g/mol. Its IUPAC name is 1-[2-[4-[(2,6-dichlorophenyl)methoxy]phenoxy]ethyl]pyrrolidine.
| Compound Name | 1-[2-[4-[(2,6-dichlorophenyl)methoxy]phenoxy]ethyl]pyrrolidine |
|---|---|
| PubChem CID | 18678156 |
| Molecular Formula | C19H21Cl2NO2 |
| Molecular Weight | 366.29 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 1-[2-[4-[(2,6-dichlorophenyl)methoxy]phenoxy]ethyl]pyrrolidine |
| SMILES | Clc1cccc(Cl)c1COc1ccc(OCCN2CCCC2)cc1 |
| InChI | InChI=1S/C19H21Cl2NO2/c20-18-4-3-5-19(21)17(18)14-24-16-8-6-15(7-9-16)23-13-12-22-10-1-2-11-22/h3-9H,1-2,10-14H2 |
| InChIKey | KPRHKZOPAALGQO-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.29 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |