C21H26Cl2N2O — CID 170863707
1-[3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]propyl]-4-methylpiperazine (PubChem CID 170863707) has the molecular formula C21H26Cl2N2O and a molecular weight of 393.36 g/mol. Its IUPAC name is 1-[3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]propyl]-4-methylpiperazine.
| Compound Name | 1-[3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]propyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 170863707 |
| Molecular Formula | C21H26Cl2N2O |
| Molecular Weight | 393.36 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 1-[3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]propyl]-4-methylpiperazine |
| SMILES | CN1CCN(CCCc2ccc(OCc3c(Cl)cccc3Cl)cc2)CC1 |
| InChI | InChI=1S/C21H26Cl2N2O/c1-24-12-14-25(15-13-24)11-3-4-17-7-9-18(10-8-17)26-16-19-20(22)5-2-6-21(19)23/h2,5-10H,3-4,11-16H2,1H3 |
| InChIKey | VEBSZHKZXKNURX-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.36 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |