C14H10Cl2N2O4 — CID 4651314
(2,6-dichlorophenyl)methyl 4-amino-3-nitrobenzoate (PubChem CID 4651314) has the molecular formula C14H10Cl2N2O4 and a molecular weight of 341.15 g/mol. Its IUPAC name is (2,6-dichlorophenyl)methyl 4-amino-3-nitrobenzoate.
| Compound Name | (2,6-dichlorophenyl)methyl 4-amino-3-nitrobenzoate |
|---|---|
| PubChem CID | 4651314 |
| Molecular Formula | C14H10Cl2N2O4 |
| Molecular Weight | 341.15 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | (2,6-dichlorophenyl)methyl 4-amino-3-nitrobenzoate |
| SMILES | Nc1ccc(C(=O)OCc2c(Cl)cccc2Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H10Cl2N2O4/c15-10-2-1-3-11(16)9(10)7-22-14(19)8-4-5-12(17)13(6-8)18(20)21/h1-6H,7,17H2 |
| InChIKey | FRGIMXHLDZTHEP-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.15 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|