About [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 4-amino-3-nitrobenzoate
[2-(5-chlorothiophen-2-yl)-2-oxoethyl] 4-amino-3-nitrobenzoate (PubChem CID 7781704) has the molecular formula C13H9ClN2O5S
and a molecular weight of 340.74 g/mol. Its IUPAC name is [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 4-amino-3-nitrobenzoate.
Molecular Properties
| Compound Name | [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 4-amino-3-nitrobenzoate |
| PubChem CID | 7781704 |
| Molecular Formula | C13H9ClN2O5S |
| Molecular Weight | 340.74 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 4-amino-3-nitrobenzoate |
| SMILES | Nc1ccc(C(=O)OCC(=O)c2ccc(Cl)s2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H9ClN2O5S/c14-12-4-3-11(22-12)10(17)6-21-13(18)7-1-2-8(15)9(5-7)16(19)20/h1-5H,6,15H2 |
| InChIKey | MUTORXVHOXPTPU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 112.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.74 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 4-amino-3-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 4-amino-3-nitrobenzoate?
The IUPAC name of [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 4-amino-3-nitrobenzoate (CID 7781704) is [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 4-amino-3-nitrobenzoate.
What is the SMILES notation for [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 4-amino-3-nitrobenzoate?
The canonical SMILES for [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 4-amino-3-nitrobenzoate is Nc1ccc(C(=O)OCC(=O)c2ccc(Cl)s2)cc1[N+](=O)[O-].
What is the InChIKey of [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 4-amino-3-nitrobenzoate?
The InChIKey is MUTORXVHOXPTPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9ClN2O5S/c14-12-4-3-11(22-12)10(17)6-21-13(18)7-1-2-8(15)9(5-7)16(19)20/h1-5H,6,15H2.
What are the key properties of [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 4-amino-3-nitrobenzoate?
[2-(5-chlorothiophen-2-yl)-2-oxoethyl] 4-amino-3-nitrobenzoate has a molecular weight of 340.74 g/mol, XLogP of 2.93, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 4-amino-3-nitrobenzoate is sourced from PubChem (CID 7781704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).