C15H12Cl2O3 — CID 925965
(2,6-dichlorophenyl)methyl 2-hydroxy-3-methylbenzoate (PubChem CID 925965) has the molecular formula C15H12Cl2O3 and a molecular weight of 311.16 g/mol. Its IUPAC name is (2,6-dichlorophenyl)methyl 2-hydroxy-3-methylbenzoate.
| Compound Name | (2,6-dichlorophenyl)methyl 2-hydroxy-3-methylbenzoate |
|---|---|
| PubChem CID | 925965 |
| Molecular Formula | C15H12Cl2O3 |
| Molecular Weight | 311.16 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | (2,6-dichlorophenyl)methyl 2-hydroxy-3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)OCc2c(Cl)cccc2Cl)c1O |
| InChI | InChI=1S/C15H12Cl2O3/c1-9-4-2-5-10(14(9)18)15(19)20-8-11-12(16)6-3-7-13(11)17/h2-7,18H,8H2,1H3 |
| InChIKey | WVQKIJSHTPNPGG-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.16 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |