C18H13Cl2NO2 — CID 2432200
(2,6-dichlorophenyl)methyl 2-methylquinoline-4-carboxylate (PubChem CID 2432200) has the molecular formula C18H13Cl2NO2 and a molecular weight of 346.21 g/mol. Its IUPAC name is (2,6-dichlorophenyl)methyl 2-methylquinoline-4-carboxylate.
| Compound Name | (2,6-dichlorophenyl)methyl 2-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 2432200 |
| Molecular Formula | C18H13Cl2NO2 |
| Molecular Weight | 346.21 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | (2,6-dichlorophenyl)methyl 2-methylquinoline-4-carboxylate |
| SMILES | Cc1cc(C(=O)OCc2c(Cl)cccc2Cl)c2ccccc2n1 |
| InChI | InChI=1S/C18H13Cl2NO2/c1-11-9-13(12-5-2-3-8-17(12)21-11)18(22)23-10-14-15(19)6-4-7-16(14)20/h2-9H,10H2,1H3 |
| InChIKey | ZTLXXOCRNORRMF-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.21 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |