C17H11Cl2NO2 — CID 3940930
(2,3-dichlorophenyl) 2-methylquinoline-4-carboxylate (PubChem CID 3940930) has the molecular formula C17H11Cl2NO2 and a molecular weight of 332.19 g/mol. Its IUPAC name is (2,3-dichlorophenyl) 2-methylquinoline-4-carboxylate.
| Compound Name | (2,3-dichlorophenyl) 2-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 3940930 |
| Molecular Formula | C17H11Cl2NO2 |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | (2,3-dichlorophenyl) 2-methylquinoline-4-carboxylate |
| SMILES | Cc1cc(C(=O)Oc2cccc(Cl)c2Cl)c2ccccc2n1 |
| InChI | InChI=1S/C17H11Cl2NO2/c1-10-9-12(11-5-2-3-7-14(11)20-10)17(21)22-15-8-4-6-13(18)16(15)19/h2-9H,1H3 |
| InChIKey | DBDLHKPQBYGJNI-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|