C22H12BrCl2NO2 — CID 3271979
(2,3-dichlorophenyl) 2-(4-bromophenyl)quinoline-4-carboxylate (PubChem CID 3271979) has the molecular formula C22H12BrCl2NO2 and a molecular weight of 473.15 g/mol. Its IUPAC name is (2,3-dichlorophenyl) 2-(4-bromophenyl)quinoline-4-carboxylate.
| Compound Name | (2,3-dichlorophenyl) 2-(4-bromophenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 3271979 |
| Molecular Formula | C22H12BrCl2NO2 |
| Molecular Weight | 473.15 g/mol |
| Exact Mass | 470.94 |
| IUPAC Name | (2,3-dichlorophenyl) 2-(4-bromophenyl)quinoline-4-carboxylate |
| SMILES | O=C(Oc1cccc(Cl)c1Cl)c1cc(-c2ccc(Br)cc2)nc2ccccc12 |
| InChI | InChI=1S/C22H12BrCl2NO2/c23-14-10-8-13(9-11-14)19-12-16(15-4-1-2-6-18(15)26-19)22(27)28-20-7-3-5-17(24)21(20)25/h1-12H |
| InChIKey | IAIFIOJFWDKGHF-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.15 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|