(4-bromophenyl)methyl 2-pyridin-4-ylquinoline-4-carboxylate

C22H15BrN2O2 — CID 2404179

IUPAC(4-bromophenyl)methyl 2-pyridin-4-ylquinoline-4-carboxylate
SMILESO=C(OCc1ccc(Br)cc1)c1cc(-c2ccncc2)nc2ccccc12
InChIInChI=1S/C22H15BrN2O2/c23-17-7-5-15(6-8-17)14-27-22(26)19-13-21(16-9-11-24-12-10-16)25-20-4-2-1-3-18(19)20/h1-13H,14H2
InChIKeyQQKKDAJUZRLQBR-UHFFFAOYSA-N
MW419.28 g/mol
LogP5.42
Rot. Bonds4

About (4-bromophenyl)methyl 2-pyridin-4-ylquinoline-4-carboxylate

(4-bromophenyl)methyl 2-pyridin-4-ylquinoline-4-carboxylate (PubChem CID 2404179) has the molecular formula C22H15BrN2O2 and a molecular weight of 419.28 g/mol. Its IUPAC name is (4-bromophenyl)methyl 2-pyridin-4-ylquinoline-4-carboxylate.

Molecular Properties

Compound Name(4-bromophenyl)methyl 2-pyridin-4-ylquinoline-4-carboxylate
PubChem CID2404179
Molecular FormulaC22H15BrN2O2
Molecular Weight419.28 g/mol
Exact Mass418.03
IUPAC Name(4-bromophenyl)methyl 2-pyridin-4-ylquinoline-4-carboxylate
SMILESO=C(OCc1ccc(Br)cc1)c1cc(-c2ccncc2)nc2ccccc12
InChIInChI=1S/C22H15BrN2O2/c23-17-7-5-15(6-8-17)14-27-22(26)19-13-21(16-9-11-24-12-10-16)25-20-4-2-1-3-18(19)20/h1-13H,14H2
InChIKeyQQKKDAJUZRLQBR-UHFFFAOYSA-N
XLogP5.42
TPSA52.08 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms27
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500419.28
LogP ≤ 55.42
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze (4-bromophenyl)methyl 2-pyridin-4-ylquinoline-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-bromophenyl)methyl 2-pyridin-4-ylquinoline-4-carboxylate?
The IUPAC name of (4-bromophenyl)methyl 2-pyridin-4-ylquinoline-4-carboxylate (CID 2404179) is (4-bromophenyl)methyl 2-pyridin-4-ylquinoline-4-carboxylate.
What is the SMILES notation for (4-bromophenyl)methyl 2-pyridin-4-ylquinoline-4-carboxylate?
The canonical SMILES for (4-bromophenyl)methyl 2-pyridin-4-ylquinoline-4-carboxylate is O=C(OCc1ccc(Br)cc1)c1cc(-c2ccncc2)nc2ccccc12.
What is the InChIKey of (4-bromophenyl)methyl 2-pyridin-4-ylquinoline-4-carboxylate?
The InChIKey is QQKKDAJUZRLQBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15BrN2O2/c23-17-7-5-15(6-8-17)14-27-22(26)19-13-21(16-9-11-24-12-10-16)25-20-4-2-1-3-18(19)20/h1-13H,14H2.
What are the key properties of (4-bromophenyl)methyl 2-pyridin-4-ylquinoline-4-carboxylate?
(4-bromophenyl)methyl 2-pyridin-4-ylquinoline-4-carboxylate has a molecular weight of 419.28 g/mol, XLogP of 5.42, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromophenyl)methyl 2-pyridin-4-ylquinoline-4-carboxylate is sourced from PubChem (CID 2404179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).