C27H24ClNO2 — CID 4317216
(4-tert-butylphenyl)methyl 2-(4-chlorophenyl)quinoline-4-carboxylate (PubChem CID 4317216) has the molecular formula C27H24ClNO2 and a molecular weight of 429.95 g/mol. Its IUPAC name is (4-tert-butylphenyl)methyl 2-(4-chlorophenyl)quinoline-4-carboxylate.
| Compound Name | (4-tert-butylphenyl)methyl 2-(4-chlorophenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 4317216 |
| Molecular Formula | C27H24ClNO2 |
| Molecular Weight | 429.95 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | (4-tert-butylphenyl)methyl 2-(4-chlorophenyl)quinoline-4-carboxylate |
| SMILES | CC(C)(C)c1ccc(COC(=O)c2cc(-c3ccc(Cl)cc3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C27H24ClNO2/c1-27(2,3)20-12-8-18(9-13-20)17-31-26(30)23-16-25(19-10-14-21(28)15-11-19)29-24-7-5-4-6-22(23)24/h4-16H,17H2,1-3H3 |
| InChIKey | UWQAVMHXYIZQLN-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.95 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |