C25H19Cl2NO2 — CID 126188190
(3,4-dichlorophenyl)methyl 2-(4-ethylphenyl)quinoline-4-carboxylate (PubChem CID 126188190) has the molecular formula C25H19Cl2NO2 and a molecular weight of 436.34 g/mol. Its IUPAC name is (3,4-dichlorophenyl)methyl 2-(4-ethylphenyl)quinoline-4-carboxylate.
| Compound Name | (3,4-dichlorophenyl)methyl 2-(4-ethylphenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 126188190 |
| Molecular Formula | C25H19Cl2NO2 |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | (3,4-dichlorophenyl)methyl 2-(4-ethylphenyl)quinoline-4-carboxylate |
| SMILES | CCc1ccc(-c2cc(C(=O)OCc3ccc(Cl)c(Cl)c3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C25H19Cl2NO2/c1-2-16-7-10-18(11-8-16)24-14-20(19-5-3-4-6-23(19)28-24)25(29)30-15-17-9-12-21(26)22(27)13-17/h3-14H,2,15H2,1H3 |
| InChIKey | GUCIMTPNCYBVDB-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |