C30H33NO2 — CID 145465198
2-[4-(4-ethylphenyl)phenyl]-4-prop-1-en-2-ylquinoline;methanol;propan-2-one (PubChem CID 145465198) has the molecular formula C30H33NO2 and a molecular weight of 439.60 g/mol. Its IUPAC name is 2-[4-(4-ethylphenyl)phenyl]-4-prop-1-en-2-ylquinoline;methanol;propan-2-one.
| Compound Name | 2-[4-(4-ethylphenyl)phenyl]-4-prop-1-en-2-ylquinoline;methanol;propan-2-one |
|---|---|
| PubChem CID | 145465198 |
| Molecular Formula | C30H33NO2 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | 2-[4-(4-ethylphenyl)phenyl]-4-prop-1-en-2-ylquinoline;methanol;propan-2-one |
| SMILES | C=C(C)c1cc(-c2ccc(-c3ccc(CC)cc3)cc2)nc2ccccc12.CC(C)=O.CO |
| InChI | InChI=1S/C26H23N.C3H6O.CH4O/c1-4-19-9-11-20(12-10-19)21-13-15-22(16-14-21)26-17-24(18(2)3)23-7-5-6-8-25(23)27-26;1-3(2)4;1-2/h5-17H,2,4H2,1,3H3;1-2H3;2H,1H3 |
| InChIKey | NGNLKWCZFOYHJT-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |