C26H20FNO3 — CID 3353845
[2-(4-ethylphenyl)-2-oxoethyl] 2-(4-fluorophenyl)quinoline-4-carboxylate (PubChem CID 3353845) has the molecular formula C26H20FNO3 and a molecular weight of 413.45 g/mol. Its IUPAC name is [2-(4-ethylphenyl)-2-oxoethyl] 2-(4-fluorophenyl)quinoline-4-carboxylate.
| Compound Name | [2-(4-ethylphenyl)-2-oxoethyl] 2-(4-fluorophenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 3353845 |
| Molecular Formula | C26H20FNO3 |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | [2-(4-ethylphenyl)-2-oxoethyl] 2-(4-fluorophenyl)quinoline-4-carboxylate |
| SMILES | CCc1ccc(C(=O)COC(=O)c2cc(-c3ccc(F)cc3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C26H20FNO3/c1-2-17-7-9-19(10-8-17)25(29)16-31-26(30)22-15-24(18-11-13-20(27)14-12-18)28-23-6-4-3-5-21(22)23/h3-15H,2,16H2,1H3 |
| InChIKey | DZUSNUKBYCCMHS-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |