C34H27NO5 — CID 126186966
[2-[4-(4-methylbenzoyl)oxyphenyl]-2-oxoethyl] 2-(4-ethylphenyl)quinoline-4-carboxylate (PubChem CID 126186966) has the molecular formula C34H27NO5 and a molecular weight of 529.59 g/mol. Its IUPAC name is [2-[4-(4-methylbenzoyl)oxyphenyl]-2-oxoethyl] 2-(4-ethylphenyl)quinoline-4-carboxylate.
| Compound Name | [2-[4-(4-methylbenzoyl)oxyphenyl]-2-oxoethyl] 2-(4-ethylphenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 126186966 |
| Molecular Formula | C34H27NO5 |
| Molecular Weight | 529.59 g/mol |
| Exact Mass | 529.19 |
| IUPAC Name | [2-[4-(4-methylbenzoyl)oxyphenyl]-2-oxoethyl] 2-(4-ethylphenyl)quinoline-4-carboxylate |
| SMILES | CCc1ccc(-c2cc(C(=O)OCC(=O)c3ccc(OC(=O)c4ccc(C)cc4)cc3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C34H27NO5/c1-3-23-10-14-24(15-11-23)31-20-29(28-6-4-5-7-30(28)35-31)34(38)39-21-32(36)25-16-18-27(19-17-25)40-33(37)26-12-8-22(2)9-13-26/h4-20H,3,21H2,1-2H3 |
| InChIKey | YTENGHCYMWITPI-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 82.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.59 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|