C27H23NO5 — CID 4220379
[2-(4-methoxyphenyl)-2-oxoethyl] 2-(4-methoxyphenyl)-6-methylquinoline-4-carboxylate (PubChem CID 4220379) has the molecular formula C27H23NO5 and a molecular weight of 441.48 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-2-oxoethyl] 2-(4-methoxyphenyl)-6-methylquinoline-4-carboxylate.
| Compound Name | [2-(4-methoxyphenyl)-2-oxoethyl] 2-(4-methoxyphenyl)-6-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 4220379 |
| Molecular Formula | C27H23NO5 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | [2-(4-methoxyphenyl)-2-oxoethyl] 2-(4-methoxyphenyl)-6-methylquinoline-4-carboxylate |
| SMILES | COc1ccc(C(=O)COC(=O)c2cc(-c3ccc(OC)cc3)nc3ccc(C)cc23)cc1 |
| InChI | InChI=1S/C27H23NO5/c1-17-4-13-24-22(14-17)23(15-25(28-24)18-5-9-20(31-2)10-6-18)27(30)33-16-26(29)19-7-11-21(32-3)12-8-19/h4-15H,16H2,1-3H3 |
| InChIKey | KCQHOHSDFXMLPL-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |