C32H32BrNO3 — CID 2063983
[2-(4-bromophenyl)-2-oxoethyl] 2-(4-heptylphenyl)-6-methylquinoline-4-carboxylate (PubChem CID 2063983) has the molecular formula C32H32BrNO3 and a molecular weight of 558.52 g/mol. Its IUPAC name is [2-(4-bromophenyl)-2-oxoethyl] 2-(4-heptylphenyl)-6-methylquinoline-4-carboxylate.
| Compound Name | [2-(4-bromophenyl)-2-oxoethyl] 2-(4-heptylphenyl)-6-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 2063983 |
| Molecular Formula | C32H32BrNO3 |
| Molecular Weight | 558.52 g/mol |
| Exact Mass | 557.16 |
| IUPAC Name | [2-(4-bromophenyl)-2-oxoethyl] 2-(4-heptylphenyl)-6-methylquinoline-4-carboxylate |
| SMILES | CCCCCCCc1ccc(-c2cc(C(=O)OCC(=O)c3ccc(Br)cc3)c3cc(C)ccc3n2)cc1 |
| InChI | InChI=1S/C32H32BrNO3/c1-3-4-5-6-7-8-23-10-12-24(13-11-23)30-20-28(27-19-22(2)9-18-29(27)34-30)32(36)37-21-31(35)25-14-16-26(33)17-15-25/h9-20H,3-8,21H2,1-2H3 |
| InChIKey | CBZFSIWMVKYSPU-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.52 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|