C21H20BrNO2 — CID 3819494
pentyl 2-(4-bromophenyl)quinoline-4-carboxylate (PubChem CID 3819494) has the molecular formula C21H20BrNO2 and a molecular weight of 398.30 g/mol. Its IUPAC name is pentyl 2-(4-bromophenyl)quinoline-4-carboxylate.
| Compound Name | pentyl 2-(4-bromophenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 3819494 |
| Molecular Formula | C21H20BrNO2 |
| Molecular Weight | 398.30 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | pentyl 2-(4-bromophenyl)quinoline-4-carboxylate |
| SMILES | CCCCCOC(=O)c1cc(-c2ccc(Br)cc2)nc2ccccc12 |
| InChI | InChI=1S/C21H20BrNO2/c1-2-3-6-13-25-21(24)18-14-20(15-9-11-16(22)12-10-15)23-19-8-5-4-7-17(18)19/h4-5,7-12,14H,2-3,6,13H2,1H3 |
| InChIKey | LGSIVUFKFQMBAC-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.30 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|