About 4-chlorobutyl 2-phenylquinoline-4-carboxylate
4-chlorobutyl 2-phenylquinoline-4-carboxylate (PubChem CID 166607303) has the molecular formula C20H18ClNO2
and a molecular weight of 339.82 g/mol. Its IUPAC name is 4-chlorobutyl 2-phenylquinoline-4-carboxylate.
Molecular Properties
| Compound Name | 4-chlorobutyl 2-phenylquinoline-4-carboxylate |
| PubChem CID | 166607303 |
| Molecular Formula | C20H18ClNO2 |
| Molecular Weight | 339.82 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 4-chlorobutyl 2-phenylquinoline-4-carboxylate |
| SMILES | O=C(OCCCCCl)c1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C20H18ClNO2/c21-12-6-7-13-24-20(23)17-14-19(15-8-2-1-3-9-15)22-18-11-5-4-10-16(17)18/h1-5,8-11,14H,6-7,12-13H2 |
| InChIKey | RFJFEWDGPDHBRJ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 339.82 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-chlorobutyl 2-phenylquinoline-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chlorobutyl 2-phenylquinoline-4-carboxylate?
The IUPAC name of 4-chlorobutyl 2-phenylquinoline-4-carboxylate (CID 166607303) is 4-chlorobutyl 2-phenylquinoline-4-carboxylate.
What is the SMILES notation for 4-chlorobutyl 2-phenylquinoline-4-carboxylate?
The canonical SMILES for 4-chlorobutyl 2-phenylquinoline-4-carboxylate is O=C(OCCCCCl)c1cc(-c2ccccc2)nc2ccccc12.
What is the InChIKey of 4-chlorobutyl 2-phenylquinoline-4-carboxylate?
The InChIKey is RFJFEWDGPDHBRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18ClNO2/c21-12-6-7-13-24-20(23)17-14-19(15-8-2-1-3-9-15)22-18-11-5-4-10-16(17)18/h1-5,8-11,14H,6-7,12-13H2.
What are the key properties of 4-chlorobutyl 2-phenylquinoline-4-carboxylate?
4-chlorobutyl 2-phenylquinoline-4-carboxylate has a molecular weight of 339.82 g/mol, XLogP of 5.08, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chlorobutyl 2-phenylquinoline-4-carboxylate is sourced from PubChem (CID 166607303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).