europium;2-phenylquinoline-4-carboxylic acid

C16H11EuNO2 — CID 87730786

IUPACeuropium;2-phenylquinoline-4-carboxylic acid
SMILESO=C(O)c1cc(-c2ccccc2)nc2ccccc12.[Eu]
InChIInChI=1S/C16H11NO2.Eu/c18-16(19)13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14;/h1-10H,(H,18,19);
InChIKeyFSPCEHNLXQDHBX-UHFFFAOYSA-N
MW401.23 g/mol
LogP3.60
Rot. Bonds2

About europium;2-phenylquinoline-4-carboxylic acid

europium;2-phenylquinoline-4-carboxylic acid (PubChem CID 87730786) has the molecular formula C16H11EuNO2 and a molecular weight of 401.23 g/mol. Its IUPAC name is europium;2-phenylquinoline-4-carboxylic acid.

Molecular Properties

Compound Nameeuropium;2-phenylquinoline-4-carboxylic acid
PubChem CID87730786
Molecular FormulaC16H11EuNO2
Molecular Weight401.23 g/mol
Exact Mass402.00
IUPAC Nameeuropium;2-phenylquinoline-4-carboxylic acid
SMILESO=C(O)c1cc(-c2ccccc2)nc2ccccc12.[Eu]
InChIInChI=1S/C16H11NO2.Eu/c18-16(19)13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14;/h1-10H,(H,18,19);
InChIKeyFSPCEHNLXQDHBX-UHFFFAOYSA-N
XLogP3.60
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500401.23
LogP ≤ 53.60
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze europium;2-phenylquinoline-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of europium;2-phenylquinoline-4-carboxylic acid?
The IUPAC name of europium;2-phenylquinoline-4-carboxylic acid (CID 87730786) is europium;2-phenylquinoline-4-carboxylic acid.
What is the SMILES notation for europium;2-phenylquinoline-4-carboxylic acid?
The canonical SMILES for europium;2-phenylquinoline-4-carboxylic acid is O=C(O)c1cc(-c2ccccc2)nc2ccccc12.[Eu].
What is the InChIKey of europium;2-phenylquinoline-4-carboxylic acid?
The InChIKey is FSPCEHNLXQDHBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11NO2.Eu/c18-16(19)13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14;/h1-10H,(H,18,19);.
What are the key properties of europium;2-phenylquinoline-4-carboxylic acid?
europium;2-phenylquinoline-4-carboxylic acid has a molecular weight of 401.23 g/mol, XLogP of 3.60, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for europium;2-phenylquinoline-4-carboxylic acid is sourced from PubChem (CID 87730786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).