C16H9F2NO2 — CID 4611633
2-(3,4-difluorophenyl)quinoline-4-carboxylic acid (PubChem CID 4611633) has the molecular formula C16H9F2NO2 and a molecular weight of 285.25 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)quinoline-4-carboxylic acid.
| Compound Name | 2-(3,4-difluorophenyl)quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 4611633 |
| Molecular Formula | C16H9F2NO2 |
| Molecular Weight | 285.25 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 2-(3,4-difluorophenyl)quinoline-4-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2ccc(F)c(F)c2)nc2ccccc12 |
| InChI | InChI=1S/C16H9F2NO2/c17-12-6-5-9(7-13(12)18)15-8-11(16(20)21)10-3-1-2-4-14(10)19-15/h1-8H,(H,20,21) |
| InChIKey | YYYJMQQEPJYIGU-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.25 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |