C16H8Cl3NO — CID 46779248
2-(3,4-dichlorophenyl)quinoline-4-carbonyl chloride (PubChem CID 46779248) has the molecular formula C16H8Cl3NO and a molecular weight of 336.61 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)quinoline-4-carbonyl chloride.
| Compound Name | 2-(3,4-dichlorophenyl)quinoline-4-carbonyl chloride |
|---|---|
| PubChem CID | 46779248 |
| Molecular Formula | C16H8Cl3NO |
| Molecular Weight | 336.61 g/mol |
| Exact Mass | 334.97 |
| IUPAC Name | 2-(3,4-dichlorophenyl)quinoline-4-carbonyl chloride |
| SMILES | O=C(Cl)c1cc(-c2ccc(Cl)c(Cl)c2)nc2ccccc12 |
| InChI | InChI=1S/C16H8Cl3NO/c17-12-6-5-9(7-13(12)18)15-8-11(16(19)21)10-3-1-2-4-14(10)20-15/h1-8H |
| InChIKey | AAOPZLLXXZINKG-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.61 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|