C35H24Cl4N4O2 — CID 3705403
2-(3,4-dichlorophenyl)-N-[3-[[2-(3,4-dichlorophenyl)quinoline-4-carbonyl]amino]propyl]quinoline-4-carboxamide (PubChem CID 3705403) has the molecular formula C35H24Cl4N4O2 and a molecular weight of 674.42 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-[3-[[2-(3,4-dichlorophenyl)quinoline-4-carbonyl]amino]propyl]quinoline-4-carboxamide.
| Compound Name | 2-(3,4-dichlorophenyl)-N-[3-[[2-(3,4-dichlorophenyl)quinoline-4-carbonyl]amino]propyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 3705403 |
| Molecular Formula | C35H24Cl4N4O2 |
| Molecular Weight | 674.42 g/mol |
| Exact Mass | 672.07 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-[3-[[2-(3,4-dichlorophenyl)quinoline-4-carbonyl]amino]propyl]quinoline-4-carboxamide |
| SMILES | O=C(NCCCNC(=O)c1cc(-c2ccc(Cl)c(Cl)c2)nc2ccccc12)c1cc(-c2ccc(Cl)c(Cl)c2)nc2ccccc12 |
| InChI | InChI=1S/C35H24Cl4N4O2/c36-26-12-10-20(16-28(26)38)32-18-24(22-6-1-3-8-30(22)42-32)34(44)40-14-5-15-41-35(45)25-19-33(21-11-13-27(37)29(39)17-21)43-31-9-4-2-7-23(25)31/h1-4,6-13,16-19H,5,14-15H2,(H,40,44)(H,41,45) |
| InChIKey | QKQFCXNTOOFSDT-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.42 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|