C21H19Cl2N3O2 — CID 8991107
N-[3-[(2,2-dichloroacetyl)amino]propyl]-2-phenylquinoline-4-carboxamide (PubChem CID 8991107) has the molecular formula C21H19Cl2N3O2 and a molecular weight of 416.31 g/mol. Its IUPAC name is N-[3-[(2,2-dichloroacetyl)amino]propyl]-2-phenylquinoline-4-carboxamide.
| Compound Name | N-[3-[(2,2-dichloroacetyl)amino]propyl]-2-phenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 8991107 |
| Molecular Formula | C21H19Cl2N3O2 |
| Molecular Weight | 416.31 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | N-[3-[(2,2-dichloroacetyl)amino]propyl]-2-phenylquinoline-4-carboxamide |
| SMILES | O=C(NCCCNC(=O)C(Cl)Cl)c1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C21H19Cl2N3O2/c22-19(23)21(28)25-12-6-11-24-20(27)16-13-18(14-7-2-1-3-8-14)26-17-10-5-4-9-15(16)17/h1-5,7-10,13,19H,6,11-12H2,(H,24,27)(H,25,28) |
| InChIKey | HMJFNCFLILGGAO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.31 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|