C40H38N4O2 — CID 4535019
2-(3-methylphenyl)-N-[6-[[2-(3-methylphenyl)quinoline-4-carbonyl]amino]hexyl]quinoline-4-carboxamide (PubChem CID 4535019) has the molecular formula C40H38N4O2 and a molecular weight of 606.77 g/mol. Its IUPAC name is 2-(3-methylphenyl)-N-[6-[[2-(3-methylphenyl)quinoline-4-carbonyl]amino]hexyl]quinoline-4-carboxamide.
| Compound Name | 2-(3-methylphenyl)-N-[6-[[2-(3-methylphenyl)quinoline-4-carbonyl]amino]hexyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 4535019 |
| Molecular Formula | C40H38N4O2 |
| Molecular Weight | 606.77 g/mol |
| Exact Mass | 606.30 |
| IUPAC Name | 2-(3-methylphenyl)-N-[6-[[2-(3-methylphenyl)quinoline-4-carbonyl]amino]hexyl]quinoline-4-carboxamide |
| SMILES | Cc1cccc(-c2cc(C(=O)NCCCCCCNC(=O)c3cc(-c4cccc(C)c4)nc4ccccc34)c3ccccc3n2)c1 |
| InChI | InChI=1S/C40H38N4O2/c1-27-13-11-15-29(23-27)37-25-33(31-17-5-7-19-35(31)43-37)39(45)41-21-9-3-4-10-22-42-40(46)34-26-38(30-16-12-14-28(2)24-30)44-36-20-8-6-18-32(34)36/h5-8,11-20,23-26H,3-4,9-10,21-22H2,1-2H3,(H,41,45)(H,42,46) |
| InChIKey | ZNFMDTJZAQSZSQ-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.77 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|