C27H34N2O — CID 4090468
2-(3,4-dimethylphenyl)-N-nonylquinoline-4-carboxamide (PubChem CID 4090468) has the molecular formula C27H34N2O and a molecular weight of 402.58 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)-N-nonylquinoline-4-carboxamide.
| Compound Name | 2-(3,4-dimethylphenyl)-N-nonylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 4090468 |
| Molecular Formula | C27H34N2O |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.27 |
| IUPAC Name | 2-(3,4-dimethylphenyl)-N-nonylquinoline-4-carboxamide |
| SMILES | CCCCCCCCCNC(=O)c1cc(-c2ccc(C)c(C)c2)nc2ccccc12 |
| InChI | InChI=1S/C27H34N2O/c1-4-5-6-7-8-9-12-17-28-27(30)24-19-26(22-16-15-20(2)21(3)18-22)29-25-14-11-10-13-23(24)25/h10-11,13-16,18-19H,4-9,12,17H2,1-3H3,(H,28,30) |
| InChIKey | YGRBVDLYDGUQPJ-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|