C24H30N3O+ — CID 4114426
2-[[2-(3,4-dimethylphenyl)quinoline-4-carbonyl]amino]ethyl-diethylazanium (PubChem CID 4114426) has the molecular formula C24H30N3O+ and a molecular weight of 376.52 g/mol. Its IUPAC name is 2-[[2-(3,4-dimethylphenyl)quinoline-4-carbonyl]amino]ethyl-diethylazanium.
| Compound Name | 2-[[2-(3,4-dimethylphenyl)quinoline-4-carbonyl]amino]ethyl-diethylazanium |
|---|---|
| PubChem CID | 4114426 |
| Molecular Formula | C24H30N3O+ |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | 2-[[2-(3,4-dimethylphenyl)quinoline-4-carbonyl]amino]ethyl-diethylazanium |
| SMILES | CC[NH+](CC)CCNC(=O)c1cc(-c2ccc(C)c(C)c2)nc2ccccc12 |
| InChI | InChI=1S/C24H29N3O/c1-5-27(6-2)14-13-25-24(28)21-16-23(19-12-11-17(3)18(4)15-19)26-22-10-8-7-9-20(21)22/h7-12,15-16H,5-6,13-14H2,1-4H3,(H,25,28)/p+1 |
| InChIKey | KAEKNACZYIGZOM-UHFFFAOYSA-O |
| XLogP | 3.17 |
| TPSA | 46.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |