C25H29N3O — CID 42749415
2-(3,4-dimethylphenyl)-N-(2-piperidin-1-ylethyl)quinoline-4-carboxamide (PubChem CID 42749415) has the molecular formula C25H29N3O and a molecular weight of 387.53 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)-N-(2-piperidin-1-ylethyl)quinoline-4-carboxamide.
| Compound Name | 2-(3,4-dimethylphenyl)-N-(2-piperidin-1-ylethyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 42749415 |
| Molecular Formula | C25H29N3O |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | 2-(3,4-dimethylphenyl)-N-(2-piperidin-1-ylethyl)quinoline-4-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)NCCN3CCCCC3)c3ccccc3n2)cc1C |
| InChI | InChI=1S/C25H29N3O/c1-18-10-11-20(16-19(18)2)24-17-22(21-8-4-5-9-23(21)27-24)25(29)26-12-15-28-13-6-3-7-14-28/h4-5,8-11,16-17H,3,6-7,12-15H2,1-2H3,(H,26,29) |
| InChIKey | HGGGRENLULSODR-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |