C23H26N2O — CID 4613424
2-(2,4-dimethylphenyl)-N-pentylquinoline-4-carboxamide (PubChem CID 4613424) has the molecular formula C23H26N2O and a molecular weight of 346.47 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)-N-pentylquinoline-4-carboxamide.
| Compound Name | 2-(2,4-dimethylphenyl)-N-pentylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 4613424 |
| Molecular Formula | C23H26N2O |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 2-(2,4-dimethylphenyl)-N-pentylquinoline-4-carboxamide |
| SMILES | CCCCCNC(=O)c1cc(-c2ccc(C)cc2C)nc2ccccc12 |
| InChI | InChI=1S/C23H26N2O/c1-4-5-8-13-24-23(26)20-15-22(18-12-11-16(2)14-17(18)3)25-21-10-7-6-9-19(20)21/h6-7,9-12,14-15H,4-5,8,13H2,1-3H3,(H,24,26) |
| InChIKey | XRYWZJFOOMZDBY-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|